What is the molecular formula of 3-Methyl-1,4-pentadiene?
The molecular formula of 3-Methyl-1,4-pentadiene is C6H10.
What is the molecular weight of 3-Methyl-1,4-pentadiene?
The molecular weight of 3-Methyl-1,4-pentadiene is 82.14 g/mol.
What is the IUPAC name of 3-Methyl-1,4-pentadiene?
The IUPAC name of 3-Methyl-1,4-pentadiene is 3-methylpenta-1,4-diene.
What is the InChI of 3-Methyl-1,4-pentadiene?
The InChI of 3-Methyl-1,4-pentadiene is InChI=1S/C6H10/c1-4-6(3)5-2/h4-6H,1-2H2,3H3.
What is the InChIKey of 3-Methyl-1,4-pentadiene?
The InChIKey of 3-Methyl-1,4-pentadiene is IKQUUYYDRTYXAP-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Methyl-1,4-pentadiene?
The canonical SMILES of 3-Methyl-1,4-pentadiene is CC(C=C)C=C.
What is the CAS number of 3-Methyl-1,4-pentadiene?
The CAS number of 3-Methyl-1,4-pentadiene is 1115-08-8.
What is the European Community (EC) number of 3-Methyl-1,4-pentadiene?
The European Community (EC) number of 3-Methyl-1,4-pentadiene is 214-221-7.
What is the UNII of 3-Methyl-1,4-pentadiene?
The UNII of 3-Methyl-1,4-pentadiene is AO4JZ46543.