What is the molecular formula of 3-Methoxynaphthalen-1-ol?
The molecular formula of 3-Methoxynaphthalen-1-ol is C11H10O2.
What is the molecular weight of 3-Methoxynaphthalen-1-ol?
The molecular weight of 3-Methoxynaphthalen-1-ol is 174.20 g/mol.
What is the IUPAC name of 3-Methoxynaphthalen-1-ol?
The IUPAC name of 3-Methoxynaphthalen-1-ol is 3-methoxynaphthalen-1-ol.
What is the InChI of 3-Methoxynaphthalen-1-ol?
The InChI of 3-Methoxynaphthalen-1-ol is InChI=1S/C11H10O2/c1-13-9-6-8-4-2-3-5-10(8)11(12)7-9/h2-7,12H,1H3.
What is the InChIKey of 3-Methoxynaphthalen-1-ol?
The InChIKey of 3-Methoxynaphthalen-1-ol is CLFHUFDVJZFIDR-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Methoxynaphthalen-1-ol?
The canonical SMILES of 3-Methoxynaphthalen-1-ol is COC1=CC2=CC=CC=C2C(=C1)O.
What is the CAS number of 3-Methoxynaphthalen-1-ol?
The CAS number of 3-Methoxynaphthalen-1-ol is 57404-85-0.
How many hydrogen bond donor counts does 3-Methoxynaphthalen-1-ol have?
3-Methoxynaphthalen-1-ol has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 3-Methoxynaphthalen-1-ol have?
3-Methoxynaphthalen-1-ol has 2 hydrogen bond acceptor counts.