What is the molecular formula of 3-Isobutoxybenzaldehyde?
The molecular formula of 3-Isobutoxybenzaldehyde is C11H14O2.
What is the molecular weight of 3-Isobutoxybenzaldehyde?
The molecular weight of 3-Isobutoxybenzaldehyde is 178.23 g/mol.
What is the IUPAC name of 3-Isobutoxybenzaldehyde?
The IUPAC name of 3-Isobutoxybenzaldehyde is 3-(2-methylpropoxy)benzaldehyde.
What is the InChI of 3-Isobutoxybenzaldehyde?
The InChI of 3-Isobutoxybenzaldehyde is InChI=1S/C11H14O2/c1-9(2)8-13-11-5-3-4-10(6-11)7-12/h3-7,9H,8H2,1-2H3.
What is the InChIKey of 3-Isobutoxybenzaldehyde?
The InChIKey of 3-Isobutoxybenzaldehyde is KYAHWUCUKPTNKW-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Isobutoxybenzaldehyde?
The canonical SMILES of 3-Isobutoxybenzaldehyde is CC(C)COC1=CC=CC(=C1)C=O.
What is the CAS number of 3-Isobutoxybenzaldehyde?
The CAS number of 3-Isobutoxybenzaldehyde is 67698-69-5.
What is the European Community (EC) number of 3-Isobutoxybenzaldehyde?
The European Community (EC) number of 3-Isobutoxybenzaldehyde is 672-091-0.
What is the DSSTox Substance ID of 3-Isobutoxybenzaldehyde?
The DSSTox Substance ID of 3-Isobutoxybenzaldehyde is DTXSID20374775.
Is 3-Isobutoxybenzaldehyde a canonicalized compound?
Yes, 3-Isobutoxybenzaldehyde is a canonicalized compound according to PubChem.