What is the molecular formula of 3-Iodoaniline?
The molecular formula of 3-Iodoaniline is C6H6IN.
What is the molecular weight of 3-Iodoaniline?
The molecular weight of 3-Iodoaniline is 219.02 g/mol.
What is the IUPAC name of 3-Iodoaniline?
The IUPAC name of 3-Iodoaniline is 3-iodoaniline.
What is the InChI of 3-Iodoaniline?
The InChI of 3-Iodoaniline is InChI=1S/C6H6IN/c7-5-2-1-3-6(8)4-5/h1-4H,8H2.
What is the InChIKey of 3-Iodoaniline?
The InChIKey of 3-Iodoaniline is FFCSRWGYGMRBGD-UHFFFAOYSA-N.
What is the CAS number of 3-Iodoaniline?
The CAS number of 3-Iodoaniline is 626-01-7.
How many hydrogen bond donor counts does 3-Iodoaniline have?
3-Iodoaniline has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 3-Iodoaniline have?
3-Iodoaniline has 1 hydrogen bond acceptor count.
What is the topological polar surface area of 3-Iodoaniline?
The topological polar surface area of 3-Iodoaniline is 26Ų.
Is 3-Iodoaniline considered to have a canonicalized compound?
Yes, 3-Iodoaniline is considered to have a canonicalized compound.