What is the molecular formula of 3-Hydroxyphenylacetylene?
The molecular formula of 3-Hydroxyphenylacetylene is C8H6O.
What are some synonyms of 3-Hydroxyphenylacetylene?
Some synonyms of 3-Hydroxyphenylacetylene include 3-Ethynylphenol and Phenol, 3-ethynyl.
What is the molecular weight of 3-Hydroxyphenylacetylene?
The molecular weight of 3-Hydroxyphenylacetylene is 118.13 g/mol.
What is the IUPAC name of 3-Hydroxyphenylacetylene?
The IUPAC name of 3-Hydroxyphenylacetylene is 3-ethynylphenol.
What is the InChI of 3-Hydroxyphenylacetylene?
The InChI of 3-Hydroxyphenylacetylene is InChI=1S/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H.
What is the InChIKey of 3-Hydroxyphenylacetylene?
The InChIKey of 3-Hydroxyphenylacetylene is AODMJIOEGCBUQL-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Hydroxyphenylacetylene?
The canonical SMILES of 3-Hydroxyphenylacetylene is C#CC1=CC(=CC=C1)O.
What is the CAS number of 3-Hydroxyphenylacetylene?
The CAS number of 3-Hydroxyphenylacetylene is 10401-11-3.
What is the hydrogen bond donor count of 3-Hydroxyphenylacetylene?
The hydrogen bond donor count of 3-Hydroxyphenylacetylene is 1.
Is 3-Hydroxyphenylacetylene a canonicalized compound?
Yes, 3-Hydroxyphenylacetylene is a canonicalized compound.