What is the molecular formula of 3-Hydroxybenzamide?
The molecular formula of 3-Hydroxybenzamide is C7H7NO2.
What is the molecular weight of 3-Hydroxybenzamide?
The molecular weight of 3-Hydroxybenzamide is 137.14 g/mol.
What is the IUPAC Name of 3-Hydroxybenzamide?
The IUPAC Name of 3-Hydroxybenzamide is 3-hydroxybenzamide.
What is the InChI of 3-Hydroxybenzamide?
The InChI of 3-Hydroxybenzamide is InChI=1S/C7H7NO2/c8-7(10)5-2-1-3-6(9)4-5/h1-4,9H,(H2,8,10).
What is the InChIKey of 3-Hydroxybenzamide?
The InChIKey of 3-Hydroxybenzamide is NGMMGKYJUWYIIG-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Hydroxybenzamide?
The canonical SMILES of 3-Hydroxybenzamide is C1=CC(=CC(=C1)O)C(=O)N.
What is the CAS number of 3-Hydroxybenzamide?
The CAS number of 3-Hydroxybenzamide is 618-49-5.
What is the XLogP3 value of 3-Hydroxybenzamide?
The XLogP3 value of 3-Hydroxybenzamide is 0.4.
Is 3-Hydroxybenzamide a canonicalized compound?
Yes, 3-Hydroxybenzamide is a canonicalized compound.