What is the molecular formula of 3-Hydroxyacetaminophen?
The molecular formula of 3-Hydroxyacetaminophen is C8H9NO3.
What are the synonyms for 3-Hydroxyacetaminophen?
The synonyms for 3-Hydroxyacetaminophen are N-(3,4-Dihydroxyphenyl)acetamide, Acetamide, N-(3,4-dihydroxyphenyl)-, and Acetaminophen metabolite 3-hydroxy-acetaminophen.
What is the molecular weight of 3-Hydroxyacetaminophen?
The molecular weight of 3-Hydroxyacetaminophen is 167.16 g/mol.
When was 3-Hydroxyacetaminophen created?
3-Hydroxyacetaminophen was created on March 26, 2005.
When was 3-Hydroxyacetaminophen last modified?
The last modification of 3-Hydroxyacetaminophen occurred on October 21, 2023.
What is the IUPAC name of 3-Hydroxyacetaminophen?
The IUPAC name of 3-Hydroxyacetaminophen is N-(3,4-dihydroxyphenyl)acetamide.
What is the InChI of 3-Hydroxyacetaminophen?
The InChI of 3-Hydroxyacetaminophen is InChI=1S/C8H9NO3/c1-5(10)9-6-2-3-7(11)8(12)4-6/h2-4,11-12H,1H3,(H,9,10).
What is the InChIKey of 3-Hydroxyacetaminophen?
The InChIKey of 3-Hydroxyacetaminophen is IPFBMHOMTSBTSU-UHFFFAOYSA-N.
What is the CAS number of 3-Hydroxyacetaminophen?
The CAS number of 3-Hydroxyacetaminophen is 37519-14-5.
What is the XLogP3 value of 3-Hydroxyacetaminophen?
The XLogP3 value of 3-Hydroxyacetaminophen is 1.2.