What is the molecular formula of 3-Heptanol?
The molecular formula of 3-Heptanol is C7H16O.
What is the molecular weight of 3-Heptanol?
The molecular weight of 3-Heptanol is 116.20 g/mol.
What is the IUPAC name of 3-Heptanol?
The IUPAC name of 3-Heptanol is heptan-3-ol.
What is the InChI code of 3-Heptanol?
The InChI code of 3-Heptanol is InChI=1S/C7H16O/c1-3-5-6-7(8)4-2/h7-8H,3-6H2,1-2H3.
What is the InChIKey of 3-Heptanol?
The InChIKey of 3-Heptanol is RZKSECIXORKHQS-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Heptanol?
The canonical SMILES of 3-Heptanol is CCCCC(CC)O.
What is the CAS number of 3-Heptanol?
The CAS number of 3-Heptanol is 589-82-2.
What is the FEMA number of 3-Heptanol?
The FEMA number of 3-Heptanol is 3547.
What is the JECFA number of 3-Heptanol?
The JECFA number of 3-Heptanol is 286.
What is the complexity of 3-Heptanol?
The complexity of 3-Heptanol is 43.7.