3-Formylphenyl 3,5-dimethoxybenzoate

• Catalog Number: ACMA00002971
• Category: Ethers
• Molecular Weight: 286.28
• Molecular Formula: C₁₆H₁₄O₄
• Hazard Statements: H317
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C16H14O5.

What is the molecular weight of the compound?

The molecular weight of the compound is 286.28 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is (3-formylphenyl) 3,5-dimethoxybenzoate.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C16H14O5/c1-19-14-7-12(8-15(9-14)20-2)16(18)21-13-5-3-4-11(6-13)10-17/h3-10H,1-2H3.

What is the InChIKey of the compound?

The InChIKey of the compound is UVHUMURGQNULMI-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is COC1=CC(=CC(=C1)C(=O)OC2=CC=CC(=C2)C=O)OC.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 2.7.

How many hydrogen bond donors does the compound have?

The compound has 0 hydrogen bond donors.

How many hydrogen bond acceptors does the compound have?

The compound has 5 hydrogen bond acceptors.

How many rotatable bonds does the compound have?

The compound has 6 rotatable bonds.