What is the molecular formula of 3-Formyl-5-(trifluoromethoxy)phenylboronic acid?
The molecular formula is C8H6BF3O4.
What are the synonyms of 3-Formyl-5-(trifluoromethoxy)phenylboronic acid?
The synonyms are 1451393-39-7, (3-Formyl-5-(trifluoromethoxy)phenyl)boronic acid, [3-formyl-5-(trifluoromethoxy)phenyl]boronic acid, and Boronic acid, B-[3-formyl-5-(trifluoromethoxy)phenyl].
What is the molecular weight of 3-Formyl-5-(trifluoromethoxy)phenylboronic acid?
The molecular weight is 233.94 g/mol.
When was 3-Formyl-5-(trifluoromethoxy)phenylboronic acid created?
It was created on August 8, 2012.
When was 3-Formyl-5-(trifluoromethoxy)phenylboronic acid last modified?
It was last modified on December 2, 2023.
What is the IUPAC name of 3-Formyl-5-(trifluoromethoxy)phenylboronic acid?
The IUPAC name is [3-formyl-5-(trifluoromethoxy)phenyl]boronic acid.
What is the InChI of 3-Formyl-5-(trifluoromethoxy)phenylboronic acid?
The InChI is InChI=1S/C8H6BF3O4/c10-8(11,12)16-7-2-5(4-13)1-6(3-7)9(14)15/h1-4,14-15H.
What is the InChIKey of 3-Formyl-5-(trifluoromethoxy)phenylboronic acid?
The InChIKey is ISVJXSCLOFBOHL-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Formyl-5-(trifluoromethoxy)phenylboronic acid?
The canonical SMILES is B(C1=CC(=CC(=C1)OC(F)(F)F)C=O)(O)O.
What is the CAS number of 3-Formyl-5-(trifluoromethoxy)phenylboronic acid?
The CAS number is 1451393-39-7.
※ Please kindly note that our products are for research use only.