What is the PubChem CID of 3-Fluorophenethylamine?
The PubChem CID of 3-Fluorophenethylamine is 533928.
What is the molecular formula of 3-Fluorophenethylamine?
The molecular formula of 3-Fluorophenethylamine is C8H10FN.
What is the molecular weight of 3-Fluorophenethylamine?
The molecular weight of 3-Fluorophenethylamine is 139.17 g/mol.
What is the IUPAC name of 3-Fluorophenethylamine?
The IUPAC name of 3-Fluorophenethylamine is 2-(3-fluorophenyl)ethanamine.
What is the InChI of 3-Fluorophenethylamine?
The InChI of 3-Fluorophenethylamine is InChI=1S/C8H10FN/c9-8-3-1-2-7(6-8)4-5-10/h1-3,6H,4-5,10H2.
What is the InChIKey of 3-Fluorophenethylamine?
The InChIKey of 3-Fluorophenethylamine is AUCVZEYHEFAWHO-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Fluorophenethylamine?
The canonical SMILES of 3-Fluorophenethylamine is C1=CC(=CC(=C1)F)CCN.
What is the CAS number of 3-Fluorophenethylamine?
The CAS number of 3-Fluorophenethylamine is 404-70-6.
What is the XLogP3 value of 3-Fluorophenethylamine?
The XLogP3 value of 3-Fluorophenethylamine is 1.7.
Is 3-Fluorophenethylamine a canonicalized compound?
Yes, 3-Fluorophenethylamine is canonicalized according to PubChem.