What is the PubChem CID of 3-Fluorobenzonitrile?
PubChem CID = 67880.
What is the molecular formula of 3-Fluorobenzonitrile?
The molecular formula is C7H4FN.
What is the molecular weight of 3-Fluorobenzonitrile?
The molecular weight is 121.11 g/mol.
What is the IUPAC name of 3-Fluorobenzonitrile?
The IUPAC name is 3-fluorobenzonitrile.
What is the InChI of 3-Fluorobenzonitrile?
The InChI is InChI=1S/C7H4FN/c8-7-3-1-2-6(4-7)5-9/h1-4H.
What is the InChIKey of 3-Fluorobenzonitrile?
The InChIKey is JZTPKAROPNTQQV-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Fluorobenzonitrile?
The canonical SMILES is C1=CC(=CC(=C1)F)C#N.
What is the CAS number of 3-Fluorobenzonitrile?
The CAS number is 403-54-3.
What is the European Community (EC) number of 3-Fluorobenzonitrile?
The European Community (EC) number is 206-963-5.
Is 3-Fluorobenzonitrile a canonicalized compound?
Yes, 3-Fluorobenzonitrile is canonicalized according to PubChem.