What is the molecular formula of 3'-Fluoroacetophenone?
The molecular formula of 3'-Fluoroacetophenone is C8H7FO.
What is the molecular weight of 3'-Fluoroacetophenone?
The molecular weight of 3'-Fluoroacetophenone is 138.14 g/mol.
What is the IUPAC name of 3'-Fluoroacetophenone?
The IUPAC name of 3'-Fluoroacetophenone is 1-(3-fluorophenyl)ethanone.
What is the InChI of 3'-Fluoroacetophenone?
The InChI of 3'-Fluoroacetophenone is InChI=1S/C8H7FO/c1-6(10)7-3-2-4-8(9)5-7/h2-5H,1H3.
What is the InChIKey of 3'-Fluoroacetophenone?
The InChIKey of 3'-Fluoroacetophenone is HCEKGPAHZCYRBZ-UHFFFAOYSA-N.
What is the canonical SMILES of 3'-Fluoroacetophenone?
The canonical SMILES of 3'-Fluoroacetophenone is CC(=O)C1=CC(=CC=C1)F.
What is the CAS number of 3'-Fluoroacetophenone?
The CAS number of 3'-Fluoroacetophenone is 455-36-7.
What is the European Community (EC) number of 3'-Fluoroacetophenone?
The European Community (EC) number of 3'-Fluoroacetophenone is 207-245-4.
What is the DSSTox Substance ID of 3'-Fluoroacetophenone?
The DSSTox Substance ID of 3'-Fluoroacetophenone is DTXSID8073186.
Is 3'-Fluoroacetophenone a covalently-bonded unit?
Yes, 3'-Fluoroacetophenone is a covalently-bonded unit.