What is the molecular formula of 3-Fluoro-5-methylaniline?
The molecular formula of 3-Fluoro-5-methylaniline is C7H8FN.
What is the molecular weight of 3-Fluoro-5-methylaniline?
The molecular weight of 3-Fluoro-5-methylaniline is 125.14 g/mol.
What is the IUPAC Name of 3-Fluoro-5-methylaniline?
The IUPAC Name of 3-Fluoro-5-methylaniline is 3-fluoro-5-methylaniline.
What is the InChI of 3-Fluoro-5-methylaniline?
The InChI of 3-Fluoro-5-methylaniline is InChI=1S/C7H8FN/c1-5-2-6(8)4-7(9)3-5/h2-4H,9H2,1H3.
What is the InChIKey of 3-Fluoro-5-methylaniline?
The InChIKey of 3-Fluoro-5-methylaniline is DPHBKGYVIHTBDG-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Fluoro-5-methylaniline?
The Canonical SMILES of 3-Fluoro-5-methylaniline is CC1=CC(=CC(=C1)F)N.
What is the CAS number of 3-Fluoro-5-methylaniline?
The CAS number of 3-Fluoro-5-methylaniline is 52215-41-5.
What is the molecular weight of 3-Fluoro-5-methylaniline according to PubChem?
The molecular weight of 3-Fluoro-5-methylaniline is 125.14 g/mol, computed by PubChem.
How many hydrogen bond acceptor counts are there in 3-Fluoro-5-methylaniline?
There are 2 hydrogen bond acceptor counts in 3-Fluoro-5-methylaniline.
Is 3-Fluoro-5-methylaniline a canonicalized compound?
Yes, 3-Fluoro-5-methylaniline is a canonicalized compound according to PubChem.