What is the PubChem CID of (3-Fluoro-4-hydroxyphenyl)boronic acid?
PubChem CID 23005361
What is the molecular formula of (3-Fluoro-4-hydroxyphenyl)boronic acid?
The molecular formula is C6H6BFO3.
What are some synonyms for (3-Fluoro-4-hydroxyphenyl)boronic acid?
Some synonyms for (3-Fluoro-4-hydroxyphenyl)boronic acid are 182344-14-5, 3-fluoro-4-hydroxyphenylboronic acid, and (3-FLUORO-4-HYDROXYPHENYL)BORONIC ACID.
What is the molecular weight of (3-Fluoro-4-hydroxyphenyl)boronic acid?
The molecular weight is 155.92 g/mol.
When was (3-Fluoro-4-hydroxyphenyl)boronic acid created and modified in PubChem?
It was created on December 5, 2007, and last modified on December 2, 2023.
What is the IUPAC name of (3-Fluoro-4-hydroxyphenyl)boronic acid?
The IUPAC name is (3-fluoro-4-hydroxyphenyl)boronic acid.
What is the InChI of (3-Fluoro-4-hydroxyphenyl)boronic acid?
The InChI of (3-Fluoro-4-hydroxyphenyl)boronic acid is InChI=1S/C6H6BFO3/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3,9-11H.
What is the InChIKey of (3-Fluoro-4-hydroxyphenyl)boronic acid?
The InChIKey is OYNDLOJPYURCJG-UHFFFAOYSA-N.
What is the canonical SMILES of (3-Fluoro-4-hydroxyphenyl)boronic acid?
The canonical SMILES is B(C1=CC(=C(C=C1)O)F)(O)O.
What is the CAS number of (3-Fluoro-4-hydroxyphenyl)boronic acid?
The CAS number is 182344-14-5.
※ Please kindly note that our products are for research use only.