What is the molecular formula of 3-Fluoro-2-nitrophenol?
The molecular formula of 3-Fluoro-2-nitrophenol is C6H4FNO3.
What is the molecular weight of 3-Fluoro-2-nitrophenol?
The molecular weight of 3-Fluoro-2-nitrophenol is 157.10 g/mol.
What is the IUPAC Name of 3-Fluoro-2-nitrophenol?
The IUPAC Name of 3-Fluoro-2-nitrophenol is 3-fluoro-2-nitrophenol.
What is the InChI of 3-Fluoro-2-nitrophenol?
The InChI of 3-Fluoro-2-nitrophenol is InChI=1S/C6H4FNO3/c7-4-2-1-3-5(9)6(4)8(10)11/h1-3,9H.
What is the InChIKey of 3-Fluoro-2-nitrophenol?
The InChIKey of 3-Fluoro-2-nitrophenol is GAWNBKUTBVLIPL-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Fluoro-2-nitrophenol?
The Canonical SMILES of 3-Fluoro-2-nitrophenol is C1=CC(=C(C(=C1)F)[N+](=O)[O-])O.
What is the CAS number of 3-Fluoro-2-nitrophenol?
The CAS number of 3-Fluoro-2-nitrophenol is 385-01-3.
What is the EC number of 3-Fluoro-2-nitrophenol?
The EC number of 3-Fluoro-2-nitrophenol is 675-091-9.
What is the DSSTox Substance ID of 3-Fluoro-2-nitrophenol?
The DSSTox Substance ID of 3-Fluoro-2-nitrophenol is DTXSID30382285.
Is 3-Fluoro-2-nitrophenol a canonicalized compound?
Yes, 3-Fluoro-2-nitrophenol is a canonicalized compound.