What is the molecular formula of 3-Fluoro-2-iodoanisole?
The molecular formula of 3-Fluoro-2-iodoanisole is C7H6FIO.
What is the molecular weight of 3-Fluoro-2-iodoanisole?
The molecular weight of 3-Fluoro-2-iodoanisole is 252.02 g/mol.
What is the IUPAC name of 3-Fluoro-2-iodoanisole?
The IUPAC name of 3-Fluoro-2-iodoanisole is 1-fluoro-2-iodo-3-methoxybenzene.
What is the InChI of 3-Fluoro-2-iodoanisole?
The InChI of 3-Fluoro-2-iodoanisole is InChI=1S/C7H6FIO/c1-10-6-4-2-3-5(8)7(6)9/h2-4H,1H3.
What is the InChIKey of 3-Fluoro-2-iodoanisole?
The InChIKey of 3-Fluoro-2-iodoanisole is CPTMVKLYWHEOMG-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Fluoro-2-iodoanisole?
The canonical SMILES of 3-Fluoro-2-iodoanisole is COC1=C(C(=CC=C1)F)I.
What is the CAS number of 3-Fluoro-2-iodoanisole?
The CAS number of 3-Fluoro-2-iodoanisole is 7079-54-1.
What is the European Community (EC) number of 3-Fluoro-2-iodoanisole?
The European Community (EC) number of 3-Fluoro-2-iodoanisole is 685-587-7.
What is the XLogP3-AA value of 3-Fluoro-2-iodoanisole?
The XLogP3-AA value of 3-Fluoro-2-iodoanisole is 2.6.
Is 3-Fluoro-2-iodoanisole a canonicalized compound?
Yes, 3-Fluoro-2-iodoanisole is a canonicalized compound.