What is the molecular formula of 3-Ethynyltoluene?
The molecular formula of 3-Ethynyltoluene is C9H8.
What is the molecular weight of 3-Ethynyltoluene?
The molecular weight of 3-Ethynyltoluene is 116.16 g/mol.
What is the IUPAC name of 3-Ethynyltoluene?
The IUPAC name of 3-Ethynyltoluene is 1-ethynyl-3-methylbenzene.
What is the InChI of 3-Ethynyltoluene?
The InChI of 3-Ethynyltoluene is InChI=1S/C9H8/c1-3-9-6-4-5-8(2)7-9/h1,4-7H,2H3.
What is the InChIKey of 3-Ethynyltoluene?
The InChIKey of 3-Ethynyltoluene is RENYIDZOAFFNHC-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Ethynyltoluene?
The canonical SMILES of 3-Ethynyltoluene is CC1=CC(=CC=C1)C#C.
What is the CAS number of 3-Ethynyltoluene?
The CAS number of 3-Ethynyltoluene is 766-82-5.
What is the XLogP3 value of 3-Ethynyltoluene?
The XLogP3 value of 3-Ethynyltoluene is 3.1.
How many rotatable bonds does 3-Ethynyltoluene have?
3-Ethynyltoluene has 1 rotatable bond.
Is 3-Ethynyltoluene a covalently-bonded unit count?
Yes, 3-Ethynyltoluene is a covalently-bonded unit count.