What is the molecular formula of 3-Ethoxybenzyl alcohol?
The molecular formula of 3-Ethoxybenzyl alcohol is C9H12O2.
What is the molecular weight of 3-Ethoxybenzyl alcohol?
The molecular weight of 3-Ethoxybenzyl alcohol is 152.19 g/mol.
What is the IUPAC name of 3-Ethoxybenzyl alcohol?
The IUPAC name of 3-Ethoxybenzyl alcohol is (3-ethoxyphenyl)methanol.
What is the InChI of 3-Ethoxybenzyl alcohol?
The InChI of 3-Ethoxybenzyl alcohol is: InChI=1S/C9H12O2/c1-2-11-9-5-3-4-8(6-9)7-10/h3-6,10H,2,7H2,1H3.
What is the InChIKey of 3-Ethoxybenzyl alcohol?
The InChIKey of 3-Ethoxybenzyl alcohol is PDYCXUZHSKLETQ-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Ethoxybenzyl alcohol?
The canonical SMILES of 3-Ethoxybenzyl alcohol is CCOC1=CC=CC(=C1)CO.
What is the CAS number of 3-Ethoxybenzyl alcohol?
The CAS number of 3-Ethoxybenzyl alcohol is 71648-21-0.
What is the XLogP3 value of 3-Ethoxybenzyl alcohol?
The XLogP3 value of 3-Ethoxybenzyl alcohol is 1.5.
How many hydrogen bond donor counts are there in 3-Ethoxybenzyl alcohol?
There is 1 hydrogen bond donor count in 3-Ethoxybenzyl alcohol.
How many hydrogen bond acceptor counts are there in 3-Ethoxybenzyl alcohol?
There are 2 hydrogen bond acceptor counts in 3-Ethoxybenzyl alcohol.