What is the PubChem CID of 3-Ethoxyacrylic acid?
PubChem CID 5709609.
What is the molecular formula of 3-Ethoxyacrylic acid?
The molecular formula is C5H8O3.
What is the molecular weight of 3-Ethoxyacrylic acid?
The molecular weight is 116.11 g/mol.
What is the IUPAC name of 3-Ethoxyacrylic acid?
The IUPAC name is (E)-3-ethoxyprop-2-enoic acid.
What is the InChI of 3-Ethoxyacrylic acid?
The InChI is InChI=1S/C5H8O3/c1-2-8-4-3-5(6)7/h3-4H,2H2,1H3,(H,6,7)/b4-3+.
What is the InChIKey of 3-Ethoxyacrylic acid?
The InChIKey is SYMAGJYJMLUEQE-ONEGZZNKSA-N.
What is the canonical SMILES of 3-Ethoxyacrylic acid?
The canonical SMILES is CCOC=CC(=O)O.
What is the isomeric SMILES of 3-Ethoxyacrylic acid?
The isomeric SMILES is CCO/C=C/C(=O)O.
What is the CAS number of 3-Ethoxyacrylic acid?
The CAS number is 6192-01-4.
Does 3-Ethoxyacrylic acid have a defined bond stereocenter count?
Yes, it has one defined bond stereocenter count.