What is the molecular formula of 3-Ethoxy-4-methoxybenzoic acid?
The molecular formula of 3-Ethoxy-4-methoxybenzoic acid is C10H12O4.
What are the synonyms of 3-Ethoxy-4-methoxybenzoic acid?
The synonyms of 3-Ethoxy-4-methoxybenzoic acid are 2651-55-0, Benzoic acid, 3-ethoxy-4-methoxy-, Maybridge1_005010, Benzoic acid, 3-ethoxy-4-methoxy-, and more.
What is the molecular weight of 3-Ethoxy-4-methoxybenzoic acid?
The molecular weight of 3-Ethoxy-4-methoxybenzoic acid is 196.20 g/mol.
What is the IUPAC name of 3-Ethoxy-4-methoxybenzoic acid?
The IUPAC name of 3-Ethoxy-4-methoxybenzoic acid is 3-ethoxy-4-methoxybenzoic acid.
What is the InChI of 3-Ethoxy-4-methoxybenzoic acid?
The InChI of 3-Ethoxy-4-methoxybenzoic acid is InChI=1S/C10H12O4/c1-3-14-9-6-7(10(11)12)4-5-8(9)13-2/h4-6H,3H2,1-2H3,(H,11,12).
What is the InChIKey of 3-Ethoxy-4-methoxybenzoic acid?
The InChIKey of 3-Ethoxy-4-methoxybenzoic acid is DMSAIFTWQMXOBE-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Ethoxy-4-methoxybenzoic acid?
The canonical SMILES of 3-Ethoxy-4-methoxybenzoic acid is CCOC1=C(C=CC(=C1)C(=O)O)OC.
What is the XLogP3 value of 3-Ethoxy-4-methoxybenzoic acid?
The XLogP3 value of 3-Ethoxy-4-methoxybenzoic acid is 2.
How many hydrogen bond donor count does 3-Ethoxy-4-methoxybenzoic acid have?
3-Ethoxy-4-methoxybenzoic acid has 1 hydrogen bond donor count.
How many hydrogen bond acceptor count does 3-Ethoxy-4-methoxybenzoic acid have?
3-Ethoxy-4-methoxybenzoic acid has 4 hydrogen bond acceptor count.
※ Please kindly note that our products are for research use only.