3-(Diethylcarbamoyl)-4-fluorophenylboronic acid is a light-stable ultraviolet absorber, which is not easy to decompose.
What is the molecular formula of the compound?
The molecular formula of the compound is C11H15BFNO3.
What are some synonyms for the compound?
Some synonyms for the compound are 874219-28-0, 3-(Diethylcarbamoyl)-4-fluorophenylboronic acid, (3-(Diethylcarbamoyl)-4-fluorophenyl)boronic acid, and 3-(Diethylcarbamoyl)-4-fluorobenzeneboronic acid.
What is the molecular weight of the compound?
The molecular weight of the compound is 239.05 g/mol.
When was the compound created and last modified?
The compound was created on March 14, 2010, and last modified on December 2, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is [3-(diethylcarbamoyl)-4-fluorophenyl]boronic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C11H15BFNO3/c1-3-14(4-2)11(15)9-7-8(12(16)17)5-6-10(9)13/h5-7,16-17H,3-4H2,1-2H3.
What is the InChIKey of the compound?
The InChIKey of the compound is CINQYDGBDNUJIH-UHFFFAOYSA-N.
What is the canonical SMILES representation of the compound?
The canonical SMILES representation of the compound is B(C1=CC(=C(C=C1)F)C(=O)N(CC)CC)(O)O.
What is the CAS number of the compound?
The CAS number of the compound is 874219-28-0.
What is the topological polar surface area of the compound?
The topological polar surface area of the compound is 60.8Ų.
※ Please kindly note that our products are for research use only.