What is the molecular formula of 3-Cyclohexen-1-ylbenzene?
The molecular formula of 3-Cyclohexen-1-ylbenzene is C12H14.
What is the molecular weight of 3-Cyclohexen-1-ylbenzene?
The molecular weight of 3-Cyclohexen-1-ylbenzene is 158.24 g/mol.
What is the IUPAC name of 3-Cyclohexen-1-ylbenzene?
The IUPAC name of 3-Cyclohexen-1-ylbenzene is cyclohex-3-en-1-ylbenzene.
What is the InChI of 3-Cyclohexen-1-ylbenzene?
The InChI of 3-Cyclohexen-1-ylbenzene is InChI=1S/C12H14/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-5,7-8,12H,6,9-10H2.
What is the InChIKey of 3-Cyclohexen-1-ylbenzene?
The InChIKey of 3-Cyclohexen-1-ylbenzene is XWCWNUSFQVJNDI-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Cyclohexen-1-ylbenzene?
The canonical SMILES of 3-Cyclohexen-1-ylbenzene is C1CC(CC=C1)C2=CC=CC=C2.
What is the CAS number of 3-Cyclohexen-1-ylbenzene?
The CAS number of 3-Cyclohexen-1-ylbenzene is 4994-16-5.
What is the UNII number of 3-Cyclohexen-1-ylbenzene?
The UNII number of 3-Cyclohexen-1-ylbenzene is CW63R89OW9.
What is the ChEMBL ID of 3-Cyclohexen-1-ylbenzene?
The ChEMBL ID of 3-Cyclohexen-1-ylbenzene is CHEMBL3185227.