What is the PubChem CID for 3-Chlorobromobenzene?
The PubChem CID for 3-Chlorobromobenzene is 7928.
What is the molecular formula of 3-Chlorobromobenzene?
The molecular formula of 3-Chlorobromobenzene is C6H4BrCl.
What is the molecular weight of 3-Chlorobromobenzene?
The molecular weight of 3-Chlorobromobenzene is 191.45 g/mol.
What is the IUPAC name of 3-Chlorobromobenzene?
The IUPAC name of 3-Chlorobromobenzene is 1-bromo-3-chlorobenzene.
What is the InChI of 3-Chlorobromobenzene?
The InChI of 3-Chlorobromobenzene is InChI=1S/C6H4BrCl/c7-5-2-1-3-6(8)4-5/h1-4H.
What is the InChIKey of 3-Chlorobromobenzene?
The InChIKey of 3-Chlorobromobenzene is JRGGUPZKKTVKOV-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Chlorobromobenzene?
The canonical SMILES of 3-Chlorobromobenzene is C1=CC(=CC(=C1)Br)Cl.
What is the CAS number of 3-Chlorobromobenzene?
The CAS number of 3-Chlorobromobenzene is 108-37-2.
What is the European Community (EC) number of 3-Chlorobromobenzene?
The European Community (EC) number of 3-Chlorobromobenzene is 203-575-8.
Is 3-Chlorobromobenzene a canonicalized compound in PubChem?
Yes, 3-Chlorobromobenzene is a canonicalized compound in PubChem.