What is the PubChem CID for 3-Chlorobenzyl chloride?
PubChem CID 12103.
What is the molecular formula of 3-Chlorobenzyl chloride?
The molecular formula is C7H6Cl2.
What is the molecular weight of 3-Chlorobenzyl chloride?
The molecular weight is 161.03 g/mol.
What is the IUPAC name of 3-Chlorobenzyl chloride?
The IUPAC name is 1-chloro-3-(chloromethyl)benzene.
What is the InChI of 3-Chlorobenzyl chloride?
The InChI is InChI=1S/C7H6Cl2/c8-5-6-2-1-3-7(9)4-6/h1-4H,5H2.
What is the InChIKey of 3-Chlorobenzyl chloride?
The InChIKey is DDGRAFHHXYIQQR-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Chlorobenzyl chloride?
The canonical SMILES is C1=CC(=CC(=C1)Cl)CCl.
What is the CAS number of 3-Chlorobenzyl chloride?
The CAS number is 620-20-2.
What is the ChEMBL ID of 3-Chlorobenzyl chloride?
The ChEMBL ID is CHEMBL3561692.
Is 3-Chlorobenzyl chloride a canonicalized compound?
Yes, it is a canonicalized compound.