What is the PubChem CID of 3-Chlorobenzyl bromide?
The PubChem CID of 3-Chlorobenzyl bromide is 69838.
What is the molecular formula of 3-Chlorobenzyl bromide?
The molecular formula of 3-Chlorobenzyl bromide is C7H6BrCl.
What is the molecular weight of 3-Chlorobenzyl bromide?
The molecular weight of 3-Chlorobenzyl bromide is 205.48 g/mol.
What is the IUPAC name of 3-Chlorobenzyl bromide?
The IUPAC name of 3-Chlorobenzyl bromide is 1-(bromomethyl)-3-chlorobenzene.
What is the InChI of 3-Chlorobenzyl bromide?
The InChI of 3-Chlorobenzyl bromide is InChI=1S/C7H6BrCl/c8-5-6-2-1-3-7(9)4-6/h1-4H,5H2.
What is the InChIKey of 3-Chlorobenzyl bromide?
The InChIKey of 3-Chlorobenzyl bromide is LZIYAIRGDHSVED-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Chlorobenzyl bromide?
The canonical SMILES of 3-Chlorobenzyl bromide is C1=CC(=CC(=C1)Cl)CBr.
What is the CAS number of 3-Chlorobenzyl bromide?
The CAS number of 3-Chlorobenzyl bromide is 766-80-3.
What is the European Community (EC) number of 3-Chlorobenzyl bromide?
The European Community (EC) number of 3-Chlorobenzyl bromide is 212-171-0.
Is 3-Chlorobenzyl bromide a canonicalized compound?
Yes, 3-Chlorobenzyl bromide is a canonicalized compound.