What is the molecular formula of 3-Chloro-5-fluoroaniline?
The molecular formula of 3-Chloro-5-fluoroaniline is C6H5ClFN.
What is the molecular weight of 3-Chloro-5-fluoroaniline?
The molecular weight of 3-Chloro-5-fluoroaniline is 145.56 g/mol.
What is the IUPAC name of 3-Chloro-5-fluoroaniline?
The IUPAC name of 3-Chloro-5-fluoroaniline is 3-chloro-5-fluoroaniline.
What is the InChI of 3-Chloro-5-fluoroaniline?
The InChI of 3-Chloro-5-fluoroaniline is InChI=1S/C6H5ClFN/c7-4-1-5(8)3-6(9)2-4/h1-3H,9H2.
What is the InChIKey of 3-Chloro-5-fluoroaniline?
The InChIKey of 3-Chloro-5-fluoroaniline is LPIFAHAICWJMRR-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Chloro-5-fluoroaniline?
The canonical SMILES of 3-Chloro-5-fluoroaniline is C1=C(C=C(C=C1F)Cl)N.
What is the CAS number of 3-Chloro-5-fluoroaniline?
The CAS number of 3-Chloro-5-fluoroaniline is 4863-91-6.
What is the EC number of 3-Chloro-5-fluoroaniline?
The EC number of 3-Chloro-5-fluoroaniline is 640-296-4.
Is 3-Chloro-5-fluoroaniline a canonicalized compound?
Yes, 3-Chloro-5-fluoroaniline is a canonicalized compound according to PubChem.