What is the molecular formula of 3-Carboxy-2,4-difluorophenylboronic acid?
The molecular formula is C7H5BF2O4.
What is the molecular weight of 3-Carboxy-2,4-difluorophenylboronic acid?
The molecular weight is 201.92 g/mol.
What is the IUPAC name of 3-Carboxy-2,4-difluorophenylboronic acid?
The IUPAC name is 3-borono-2,6-difluorobenzoic acid.
What is the InChI of 3-Carboxy-2,4-difluorophenylboronic acid?
The InChI is InChI=1S/C7H5BF2O4/c9-4-2-1-3(8(13)14)6(10)5(4)7(11)12/h1-2,13-14H,(H,11,12).
What is the InChIKey of 3-Carboxy-2,4-difluorophenylboronic acid?
The InChIKey is YKUGBPFCJTZDIQ-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Carboxy-2,4-difluorophenylboronic acid?
The canonical SMILES is B(C1=C(C(=C(C=C1)F)C(=O)O)F)(O)O.
What is the CAS number of 3-Carboxy-2,4-difluorophenylboronic acid?
The CAS number is 1451393-05-7.
What is the hydrogen bond donor count of 3-Carboxy-2,4-difluorophenylboronic acid?
The hydrogen bond donor count is 3.
What is the hydrogen bond acceptor count of 3-Carboxy-2,4-difluorophenylboronic acid?
The hydrogen bond acceptor count is 6.
Is 3-Carboxy-2,4-difluorophenylboronic acid a canonicalized compound?
Yes, 3-Carboxy-2,4-difluorophenylboronic acid is canonicalized.