What is the molecular formula of (3-Butoxyphenyl)amine?
The molecular formula is C10H15NO.
What is the molecular weight of (3-Butoxyphenyl)amine?
The molecular weight is 165.23 g/mol.
What is the IUPAC name of (3-Butoxyphenyl)amine?
The IUPAC name is 3-butoxyaniline.
What is the InChI of (3-Butoxyphenyl)amine?
The InChI is InChI=1S/C10H15NO/c1-2-3-7-12-10-6-4-5-9(11)8-10/h4-6,8H,2-3,7,11H2,1H3.
What is the InChIKey of (3-Butoxyphenyl)amine?
The InChIKey is ZIZHOYOBASUITD-UHFFFAOYSA-N.
What is the canonical SMILES of (3-Butoxyphenyl)amine?
The canonical SMILES is CCCCOC1=CC=CC(=C1)N.
What is the CAS number of (3-Butoxyphenyl)amine?
The CAS number is 23079-68-7.
What is the XLogP3 value of (3-Butoxyphenyl)amine?
The XLogP3 value is 2.7.
How many hydrogen bond donor counts are there in (3-Butoxyphenyl)amine?
There is one hydrogen bond donor count.
How many hydrogen bond acceptor counts are there in (3-Butoxyphenyl)amine?
There are two hydrogen bond acceptor counts.