What is the molecular formula of 3-Bromophenylacetyl chloride?
The molecular formula of 3-Bromophenylacetyl chloride is C8H6BrClO.
What is the molecular weight of 3-Bromophenylacetyl chloride?
The molecular weight of 3-Bromophenylacetyl chloride is 233.49 g/mol.
What are some synonyms for 3-Bromophenylacetyl chloride?
Some synonyms for 3-Bromophenylacetyl chloride are 98288-51-8, 2-(3-bromophenyl)acetyl chloride, (3-bromophenyl)acetyl chloride, benzeneacetyl chloride, and 3-bromo.
What is the IUPAC name of 3-Bromophenylacetyl chloride?
The IUPAC name of 3-Bromophenylacetyl chloride is 2-(3-bromophenyl)acetyl chloride.
What is the InChI of 3-Bromophenylacetyl chloride?
The InChI of 3-Bromophenylacetyl chloride is InChI=1S/C8H6BrClO/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4H,5H2.
What is the InChIKey of 3-Bromophenylacetyl chloride?
The InChIKey of 3-Bromophenylacetyl chloride is DFKQZCVLSJIRES-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromophenylacetyl chloride?
The canonical SMILES of 3-Bromophenylacetyl chloride is C1=CC(=CC(=C1)Br)CC(=O)Cl.
What is the CAS number of 3-Bromophenylacetyl chloride?
The CAS number of 3-Bromophenylacetyl chloride is 98288-51-8.
Is 3-Bromophenylacetyl chloride a canonicalized compound?
Yes, 3-Bromophenylacetyl chloride is a canonicalized compound.
※ Please kindly note that our products are for research use only.