What is the molecular formula of 3-Bromobenzoyl chloride?
The molecular formula of 3-Bromobenzoyl chloride is C7H4BrClO.
What is the molecular weight of 3-Bromobenzoyl chloride?
The molecular weight of 3-Bromobenzoyl chloride is 219.46 g/mol.
What is the IUPAC name of 3-Bromobenzoyl chloride?
The IUPAC name of 3-Bromobenzoyl chloride is 3-bromobenzoyl chloride.
What is the InChI of 3-Bromobenzoyl chloride?
The InChI of 3-Bromobenzoyl chloride is InChI=1S/C7H4BrClO/c8-6-3-1-2-5(4-6)7(9)10/h1-4H.
What is the InChIKey of 3-Bromobenzoyl chloride?
The InChIKey of 3-Bromobenzoyl chloride is PBOOZQFGWNZNQE-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromobenzoyl chloride?
The canonical SMILES of 3-Bromobenzoyl chloride is C1=CC(=CC(=C1)Br)C(=O)Cl.
What is the CAS number of 3-Bromobenzoyl chloride?
The CAS number of 3-Bromobenzoyl chloride is 1711-09-7.
What is the EC number of 3-Bromobenzoyl chloride?
The EC number of 3-Bromobenzoyl chloride is 216-978-9.
What is the DSSTox Substance ID of 3-Bromobenzoyl chloride?
The DSSTox Substance ID of 3-Bromobenzoyl chloride is DTXSID0061907.
Is 3-Bromobenzoyl chloride a canonicalized compound?
Yes, 3-Bromobenzoyl chloride is a canonicalized compound.