What is the PubChem CID for 3-Bromoacetylcoumarin?
The PubChem CID for 3-Bromoacetylcoumarin is 2063461.
What is the molecular formula of 3-Bromoacetylcoumarin?
The molecular formula of 3-Bromoacetylcoumarin is C11H7BrO3.
What is the molecular weight of 3-Bromoacetylcoumarin?
The molecular weight of 3-Bromoacetylcoumarin is 267.07 g/mol.
What is the IUPAC name of 3-Bromoacetylcoumarin?
The IUPAC name of 3-Bromoacetylcoumarin is 3-(2-bromoacetyl)chromen-2-one.
What is the InChIKey of 3-Bromoacetylcoumarin?
The InChIKey of 3-Bromoacetylcoumarin is NTYOLVNSXVYRTJ-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Bromoacetylcoumarin?
The Canonical SMILES of 3-Bromoacetylcoumarin is C1=CC=C2C(=C1)C=C(C(=O)O2)C(=O)CBr.
What is the CAS number of 3-Bromoacetylcoumarin?
The CAS number of 3-Bromoacetylcoumarin is 29310-88-1.
What is the XLogP3-AA value of 3-Bromoacetylcoumarin?
The XLogP3-AA value of 3-Bromoacetylcoumarin is 2.6.
What is the hydrogen bond acceptor count of 3-Bromoacetylcoumarin?
The hydrogen bond acceptor count of 3-Bromoacetylcoumarin is 3.
Is 3-Bromoacetylcoumarin a canonicalized compound?
Yes, 3-Bromoacetylcoumarin is a canonicalized compound.