What is the molecular formula of 3-Bromo-7-chloroindole?
The molecular formula of 3-Bromo-7-chloroindole is C8H5BrClN.
What is the molecular weight of 3-Bromo-7-chloroindole?
The molecular weight of 3-Bromo-7-chloroindole is 230.49 g/mol.
When was 3-Bromo-7-chloroindole created?
3-Bromo-7-chloroindole was created on July 19, 2005.
When was the last modification made to 3-Bromo-7-chloroindole?
The last modification was made on December 2, 2023.
What is the IUPAC name of 3-Bromo-7-chloroindole?
The IUPAC name of 3-Bromo-7-chloroindole is 3-bromo-7-chloro-1H-indole.
What is the InChI key of 3-Bromo-7-chloroindole?
The InChI key of 3-Bromo-7-chloroindole is UYTCAWQZFCASCT-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Bromo-7-chloroindole?
The Canonical SMILES of 3-Bromo-7-chloroindole is C1=CC2=C(C(=C1)Cl)NC=C2Br.
What is the CAS number of 3-Bromo-7-chloroindole?
The CAS number of 3-Bromo-7-chloroindole is 78225-46-4.
What is the XLogP3-AA value of 3-Bromo-7-chloroindole?
The XLogP3-AA value of 3-Bromo-7-chloroindole is 3.4.
Is 3-Bromo-7-chloroindole a canonicalized compound?
Yes, 3-Bromo-7-chloroindole is a canonicalized compound.