What is the molecular formula of 3-Bromo-5-methoxyphenol?
The molecular formula of 3-Bromo-5-methoxyphenol is C7H7BrO2.
What is the molecular weight of 3-Bromo-5-methoxyphenol?
The molecular weight of 3-Bromo-5-methoxyphenol is 203.03 g/mol.
What is the IUPAC name of 3-Bromo-5-methoxyphenol?
The IUPAC name of 3-Bromo-5-methoxyphenol is 3-bromo-5-methoxyphenol.
What is the InChI of 3-Bromo-5-methoxyphenol?
The InChI of 3-Bromo-5-methoxyphenol is InChI=1S/C7H7BrO2/c1-10-7-3-5(8)2-6(9)4-7/h2-4,9H,1H3.
What is the InChIKey of 3-Bromo-5-methoxyphenol?
The InChIKey of 3-Bromo-5-methoxyphenol is QFOYNYXCBBRSCY-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-5-methoxyphenol?
The canonical SMILES of 3-Bromo-5-methoxyphenol is COC1=CC(=CC(=C1)O)Br.
What is the CAS number of 3-Bromo-5-methoxyphenol?
The CAS number of 3-Bromo-5-methoxyphenol is 855400-66-7.
What is the European Community (EC) number of 3-Bromo-5-methoxyphenol?
The European Community (EC) number of 3-Bromo-5-methoxyphenol is 800-795-1.
What is the XLogP3 value of 3-Bromo-5-methoxyphenol?
The XLogP3 value of 3-Bromo-5-methoxyphenol is 2.4.
Is 3-Bromo-5-methoxyphenol a canonicalized compound?
Yes, 3-Bromo-5-methoxyphenol is a canonicalized compound.