What is the molecular formula of 3-Bromo-5-iodo-pyridine?
The molecular formula of 3-Bromo-5-iodo-pyridine is C5H3BrIN.
What is the molecular weight of 3-Bromo-5-iodo-pyridine?
The molecular weight of 3-Bromo-5-iodo-pyridine is 283.89 g/mol.
What is the IUPAC name of 3-Bromo-5-iodo-pyridine?
The IUPAC name of 3-Bromo-5-iodo-pyridine is 3-bromo-5-iodopyridine.
What is the InChI of 3-Bromo-5-iodo-pyridine?
The InChI of 3-Bromo-5-iodo-pyridine is InChI=1S/C5H3BrIN/c6-4-1-5(7)3-8-2-4/h1-3H.
What is the InChIKey of 3-Bromo-5-iodo-pyridine?
The InChIKey of 3-Bromo-5-iodo-pyridine is AOOZLVWDZUPEHT-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-5-iodo-pyridine?
The canonical SMILES of 3-Bromo-5-iodo-pyridine is C1=C(C=NC=C1I)Br.
What is the CAS number of 3-Bromo-5-iodo-pyridine?
The CAS number of 3-Bromo-5-iodo-pyridine is 233770-01-9.
What is the European Community Number of 3-Bromo-5-iodo-pyridine?
The European Community Number of 3-Bromo-5-iodo-pyridine is 625-265-5.
What is the DSSTox Substance ID of 3-Bromo-5-iodo-pyridine?
The DSSTox Substance ID of 3-Bromo-5-iodo-pyridine is DTXSID50356206.
Is 3-Bromo-5-iodo-pyridine a canonicalized compound?
Yes, 3-Bromo-5-iodo-pyridine is a canonicalized compound.