What is the molecular formula of 3-Bromo-5-chlorotoluene?
The molecular formula of 3-Bromo-5-chlorotoluene is C7H6BrCl.
What is the molecular weight of 3-Bromo-5-chlorotoluene?
The molecular weight of 3-Bromo-5-chlorotoluene is 205.48 g/mol.
What is the IUPAC name of 3-Bromo-5-chlorotoluene?
The IUPAC name of 3-Bromo-5-chlorotoluene is 1-bromo-3-chloro-5-methylbenzene.
What is the InChI of 3-Bromo-5-chlorotoluene?
The InChI of 3-Bromo-5-chlorotoluene is InChI=1S/C7H6BrCl/c1-5-2-6(8)4-7(9)3-5/h2-4H,1H3.
What is the InChIKey of 3-Bromo-5-chlorotoluene?
The InChIKey of 3-Bromo-5-chlorotoluene is YRIKDGJWRMHTJP-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-5-chlorotoluene?
The canonical SMILES of 3-Bromo-5-chlorotoluene is CC1=CC(=CC(=C1)Br)Cl.
What is the CAS number of 3-Bromo-5-chlorotoluene?
The CAS number of 3-Bromo-5-chlorotoluene is 329944-72-1.
What is the European Community (EC) number of 3-Bromo-5-chlorotoluene?
The European Community (EC) number of 3-Bromo-5-chlorotoluene is 810-589-3.
What is the DSSTox Substance ID of 3-Bromo-5-chlorotoluene?
The DSSTox Substance ID of 3-Bromo-5-chlorotoluene is DTXSID70444715.
Is 3-Bromo-5-chlorotoluene a canonicalized compound?
Yes, 3-Bromo-5-chlorotoluene is a canonicalized compound.