What is the molecular formula of 3-Bromo-5-chlorophenol?
The molecular formula of 3-Bromo-5-chlorophenol is C6H4BrClO.
What is the molecular weight of 3-Bromo-5-chlorophenol?
The molecular weight of 3-Bromo-5-chlorophenol is 207.45 g/mol.
What is the IUPAC name of 3-Bromo-5-chlorophenol?
The IUPAC name of 3-Bromo-5-chlorophenol is 3-bromo-5-chlorophenol.
What is the InChI of 3-Bromo-5-chlorophenol?
The InChI of 3-Bromo-5-chlorophenol is InChI=1S/C6H4BrClO/c7-4-1-5(8)3-6(9)2-4/h1-3,9H.
What is the InChIKey of 3-Bromo-5-chlorophenol?
The InChIKey of 3-Bromo-5-chlorophenol is GMGWXLPFRHYWAS-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-5-chlorophenol?
The canonical SMILES of 3-Bromo-5-chlorophenol is C1=C(C=C(C=C1Cl)Br)O.
What is the CAS number of 3-Bromo-5-chlorophenol?
The CAS number of 3-Bromo-5-chlorophenol is 56962-04-0.
What is the EC number of 3-Bromo-5-chlorophenol?
The EC number of 3-Bromo-5-chlorophenol is 611-435-6.
Is 3-Bromo-5-chlorophenol a canonicalized compound?
Yes, 3-Bromo-5-chlorophenol is a canonicalized compound according to PubChem.