What is the molecular formula of 3-Bromo-4-methylaniline?
The molecular formula is C7H8BrN.
What is the molecular weight of 3-Bromo-4-methylaniline?
The molecular weight is 186.05 g/mol.
What is the IUPAC name of 3-Bromo-4-methylaniline?
The IUPAC name is 3-bromo-4-methylaniline.
What is the InChI of 3-Bromo-4-methylaniline?
The InChI is InChI=1S/C7H8BrN/c1-5-2-3-6(9)4-7(5)8/h2-4H,9H2,1H3.
What is the InChIKey of 3-Bromo-4-methylaniline?
The InChIKey is GRXMMIBZRMKADT-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-4-methylaniline?
The canonical SMILES is CC1=C(C=C(C=C1)N)Br.
What is the CAS number of 3-Bromo-4-methylaniline?
The CAS number is 7745-91-7.
What is the molecular weight of 3-Bromo-4-methylaniline according to PubChem?
The molecular weight is 186.05 g/mol.
What is the XLogP3 value of 3-Bromo-4-methylaniline?
The XLogP3 value is 1.5.
Is 3-Bromo-4-methylaniline a canonicalized compound?
Yes, 3-Bromo-4-methylaniline is canonicalized.