What is the molecular formula of 3-Bromo-4-methoxyaniline?
The molecular formula of 3-Bromo-4-methoxyaniline is C7H8BrNO.
What is the molecular weight of 3-Bromo-4-methoxyaniline?
The molecular weight of 3-Bromo-4-methoxyaniline is 202.05 g/mol.
What is the IUPAC name of 3-Bromo-4-methoxyaniline?
The IUPAC name of 3-Bromo-4-methoxyaniline is 3-bromo-4-methoxyaniline.
What are the synonyms of 3-Bromo-4-methoxyaniline?
The synonyms of 3-Bromo-4-methoxyaniline are 4-Amino-2-bromoanisole and Benzenamine, 3-bromo-4-methoxy.
What is the InChI of 3-Bromo-4-methoxyaniline?
The InChI of 3-Bromo-4-methoxyaniline is InChI=1S/C7H8BrNO/c1-10-7-3-2-5(9)4-6(7)8/h2-4H,9H2,1H3.
What is the InChIKey of 3-Bromo-4-methoxyaniline?
The InChIKey of 3-Bromo-4-methoxyaniline is NMUFTXMBONJQTC-UHFFFAOYSA-N.
What is the CAS number of 3-Bromo-4-methoxyaniline?
The CAS number of 3-Bromo-4-methoxyaniline is 19056-41-8.
What is the molecular weight of 3-Bromo-4-methoxyaniline based on PubChem?
The molecular weight of 3-Bromo-4-methoxyaniline based on PubChem is 202.05 g/mol.
What is the XLogP3 value of 3-Bromo-4-methoxyaniline?
The XLogP3 value of 3-Bromo-4-methoxyaniline is 1.9.
Is 3-Bromo-4-methoxyaniline a covalently-bonded unit?
Yes, 3-Bromo-4-methoxyaniline is a covalently-bonded unit.