What is the molecular formula of 3-Bromo-4-chloroanisole?
The molecular formula is C7H6BrClO.
What is the molecular weight of 3-Bromo-4-chloroanisole?
The molecular weight is 221.48 g/mol.
What is the IUPAC name of 3-Bromo-4-chloroanisole?
The IUPAC name is 2-bromo-1-chloro-4-methoxybenzene.
What is the InChI of 3-Bromo-4-chloroanisole?
The InChI is InChI=1S/C7H6BrClO/c1-10-5-2-3-7(9)6(8)4-5/h2-4H,1H3.
What is the InChIKey of 3-Bromo-4-chloroanisole?
The InChIKey is SQHMXVXKKCXIGN-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Bromo-4-chloroanisole?
The Canonical SMILES is COC1=CC(=C(C=C1)Cl)Br.
What is the CAS number of 3-Bromo-4-chloroanisole?
The CAS number is 2732-80-1.
What is the XLogP3 value of 3-Bromo-4-chloroanisole?
The XLogP3 value is 3.2.
How many hydrogen bond donor counts does 3-Bromo-4-chloroanisole have?
It has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 3-Bromo-4-chloroanisole have?
It has 1 hydrogen bond acceptor count.