What is the molecular formula of 3-Bromo-2-chloropyridine?
The molecular formula of 3-Bromo-2-chloropyridine is C5H3BrClN.
What is the molecular weight of 3-Bromo-2-chloropyridine?
The molecular weight of 3-Bromo-2-chloropyridine is 192.44 g/mol.
What is the IUPAC name of 3-Bromo-2-chloropyridine?
The IUPAC name of 3-Bromo-2-chloropyridine is 3-bromo-2-chloropyridine.
What is the InChI of 3-Bromo-2-chloropyridine?
The InChI of 3-Bromo-2-chloropyridine is InChI=1S/C5H3BrClN/c6-4-2-1-3-8-5(4)7/h1-3H.
What is the InChIKey of 3-Bromo-2-chloropyridine?
The InChIKey of 3-Bromo-2-chloropyridine is HDYNIWBNWMFBDO-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-2-chloropyridine?
The canonical SMILES of 3-Bromo-2-chloropyridine is C1=CC(=C(N=C1)Cl)Br.
What is the CAS number of 3-Bromo-2-chloropyridine?
The CAS number of 3-Bromo-2-chloropyridine is 52200-48-3.
What is the EC number of 3-Bromo-2-chloropyridine?
The EC number of 3-Bromo-2-chloropyridine is 629-254-6.
Is 3-Bromo-2-chloropyridine a canonicalized compound?
Yes, 3-Bromo-2-chloropyridine is a canonicalized compound according to PubChem.