What is the molecular formula of 3-Bromo-1-butyne?
The molecular formula of 3-Bromo-1-butyne is C4H5Br.
What is the molecular weight of 3-Bromo-1-butyne?
The molecular weight of 3-Bromo-1-butyne is 132.99 g/mol.
What is the IUPAC name of 3-Bromo-1-butyne?
The IUPAC name of 3-Bromo-1-butyne is 3-bromobut-1-yne.
What is the InChI of 3-Bromo-1-butyne?
The InChI of 3-Bromo-1-butyne is InChI=1S/C4H5Br/c1-3-4(2)5/h1,4H,2H3.
What is the InChIKey of 3-Bromo-1-butyne?
The InChIKey of 3-Bromo-1-butyne is PYJVGTWBTIEAMV-UHFFFAOYSA-N.
What is the CAS number of 3-Bromo-1-butyne?
The CAS number of 3-Bromo-1-butyne is 18668-72-9.
What is the EC number of 3-Bromo-1-butyne?
The EC number of 3-Bromo-1-butyne is 623-994-3.
What is the XLogP3-AA value of 3-Bromo-1-butyne?
The XLogP3-AA value of 3-Bromo-1-butyne is 1.5.
Is 3-Bromo-1-butyne a canonicalized compound?
Yes, 3-Bromo-1-butyne is a canonicalized compound.