What is the molecular formula of 3-Amino-4-fluorophenylboronic acid, pinacol ester?
The molecular formula of 3-Amino-4-fluorophenylboronic acid, pinacol ester is C12H17BFNO2.
What are the synonyms for 3-Amino-4-fluorophenylboronic acid, pinacol ester?
The synonyms for 3-Amino-4-fluorophenylboronic acid, pinacol ester are: 1003575-43-6 2-Fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline 3-AMINO-4-FLUOROPHENYLBORONIC ACID, PINACOL ESTER 3-Amino-4-fluorophenylboronic acid pinacol ester MFCD11044430
What is the molecular weight of 3-Amino-4-fluorophenylboronic acid, pinacol ester?
The molecular weight of 3-Amino-4-fluorophenylboronic acid, pinacol ester is 237.08 g/mol.
What is the IUPAC Name of 3-Amino-4-fluorophenylboronic acid, pinacol ester?
The IUPAC Name of 3-Amino-4-fluorophenylboronic acid, pinacol ester is 2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
What is the InChI code of 3-Amino-4-fluorophenylboronic acid, pinacol ester?
The InChI code of 3-Amino-4-fluorophenylboronic acid, pinacol ester is InChI=1S/C12H17BFNO2/c1-11(2)12(3,4)17-13(16-11)8-5-6-9(14)10(15)7-8/h5-7H,15H2,1-4H3.
What is the InChIKey of 3-Amino-4-fluorophenylboronic acid, pinacol ester?
The InChIKey of 3-Amino-4-fluorophenylboronic acid, pinacol ester is VXNIVUKZNDRJBW-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Amino-4-fluorophenylboronic acid, pinacol ester?
The Canonical SMILES of 3-Amino-4-fluorophenylboronic acid, pinacol ester is B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)F)N.
What is the CAS number of 3-Amino-4-fluorophenylboronic acid, pinacol ester?
The CAS number of 3-Amino-4-fluorophenylboronic acid, pinacol ester is 1003575-43-6.
What is the hydrogen bond donor count of 3-Amino-4-fluorophenylboronic acid, pinacol ester?
The hydrogen bond donor count of 3-Amino-4-fluorophenylboronic acid, pinacol ester is 1.
What is the hydrogen bond acceptor count of 3-Amino-4-fluorophenylboronic acid, pinacol ester?
The hydrogen bond acceptor count of 3-Amino-4-fluorophenylboronic acid, pinacol ester is 4.
※ Please kindly note that our products are for research use only.