What is the molecular formula of 3-Amino-1-adamantanol?
The molecular formula of 3-Amino-1-adamantanol is C10H17NO.
What is the molecular weight of 3-Amino-1-adamantanol?
The molecular weight of 3-Amino-1-adamantanol is 167.25 g/mol.
What is the IUPAC name of 3-Amino-1-adamantanol?
The IUPAC name of 3-Amino-1-adamantanol is 3-aminoadamantan-1-ol.
What is the InChI of 3-Amino-1-adamantanol?
The InChI of 3-Amino-1-adamantanol is InChI=1S/C10H17NO/c11-9-2-7-1-8(3-9)5-10(12,4-7)6-9/h7-8,12H,1-6,11H2.
What is the InChIKey of 3-Amino-1-adamantanol?
The InChIKey of 3-Amino-1-adamantanol is DWPIPTNBOVJYAD-UHFFFAOYSA-N.
What is the Canonical SMILES of 3-Amino-1-adamantanol?
The Canonical SMILES of 3-Amino-1-adamantanol is C1C2CC3(CC1CC(C2)(C3)O)N.
What is the CAS number of 3-Amino-1-adamantanol?
The CAS number of 3-Amino-1-adamantanol is 702-82-9.
What is the European Community (EC) number of 3-Amino-1-adamantanol?
The European Community (EC) number of 3-Amino-1-adamantanol is 615-098-6.
What is the XLogP3-AA value of 3-Amino-1-adamantanol?
The XLogP3-AA value of 3-Amino-1-adamantanol is 0.5.
Is 3-Amino-1-adamantanol a canonicalized compound?
Yes, 3-Amino-1-adamantanol is a canonicalized compound.