What is the molecular formula of 3-Acetoxy-4-methoxycarbonylphenylboronic acid, pinacol ester?
The molecular formula is C16H21BO6.
What are the synonyms for 3-Acetoxy-4-methoxycarbonylphenylboronic acid, pinacol ester?
The synonyms are 1073355-18-6, Methyl 2-acetoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, and others.
What is the molecular weight of 3-Acetoxy-4-methoxycarbonylphenylboronic acid, pinacol ester?
The molecular weight is 320.1 g/mol.
When was the compound created and last modified?
The compound was created on March 14, 2010, and last modified on December 2, 2023.
What is the IUPAC name of 3-Acetoxy-4-methoxycarbonylphenylboronic acid, pinacol ester?
The IUPAC name is methyl 2-acetyloxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
What is the InChI of 3-Acetoxy-4-methoxycarbonylphenylboronic acid, pinacol ester?
The InChI is InChI=1S/C16H21BO6/c1-10(18)21-13-9-11(7-8-12(13)14(19)20-6)17-22-15(2,3)16(4,5)23-17/h7-9H,1-6H3.
What is the InChIKey of 3-Acetoxy-4-methoxycarbonylphenylboronic acid, pinacol ester?
The InChIKey is ZUWNUDWHBMLHSH-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Acetoxy-4-methoxycarbonylphenylboronic acid, pinacol ester?
The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)OC)OC(=O)C.
What is the CAS number of 3-Acetoxy-4-methoxycarbonylphenylboronic acid, pinacol ester?
The CAS number is 1073355-18-6.
What is the molecular weight, hydrogen bond donor count, hydrogen bond acceptor count, and rotatable bond count of 3-Acetoxy-4-methoxycarbonylphenylboronic acid, pinacol ester?
The molecular weight is 320.1 g/mol, the hydrogen bond donor count is 0, the hydrogen bond acceptor count is 6, and the rotatable bond count is 5.
※ Please kindly note that our products are for research use only.