What is the molecular formula of 3,7-Dimethyl-1-octene?
The molecular formula of 3,7-Dimethyl-1-octene is C10H20.
What is the molecular weight of 3,7-Dimethyl-1-octene?
The molecular weight of 3,7-Dimethyl-1-octene is 140.27 g/mol.
What is the IUPAC name of 3,7-Dimethyl-1-octene?
The IUPAC name of 3,7-Dimethyl-1-octene is 3,7-dimethyloct-1-ene.
What is the InChI of 3,7-Dimethyl-1-octene?
The InChI of 3,7-Dimethyl-1-octene is InChI=1S/C10H20/c1-5-10(4)8-6-7-9(2)3/h5,9-10H,1,6-8H2,2-4H3.
What is the InChIKey of 3,7-Dimethyl-1-octene?
The InChIKey of 3,7-Dimethyl-1-octene is KSXTZYRIJKDCEA-UHFFFAOYSA-N.
What is the canonical SMILES of 3,7-Dimethyl-1-octene?
The canonical SMILES of 3,7-Dimethyl-1-octene is CC(C)CCCC(C)C=C.
What is the CAS number of 3,7-Dimethyl-1-octene?
The CAS number of 3,7-Dimethyl-1-octene is 4984-01-4.
What is the European Community (EC) number of 3,7-Dimethyl-1-octene?
The European Community (EC) number of 3,7-Dimethyl-1-octene is 225-635-2.
What is the DSSTox Substance ID of 3,7-Dimethyl-1-octene?
The DSSTox Substance ID of 3,7-Dimethyl-1-octene is DTXSID30871109.
What is the XLogP3-AA value of 3,7-Dimethyl-1-octene?
The XLogP3-AA value of 3,7-Dimethyl-1-octene is 4.6.