What is the molecular formula of 3,5-Dimethoxystilbene?
The molecular formula of 3,5-Dimethoxystilbene is C16H16O2.
What is the molecular weight of 3,5-Dimethoxystilbene?
The molecular weight of 3,5-Dimethoxystilbene is 240.30 g/mol.
What is the IUPAC Name of 3,5-Dimethoxystilbene?
The IUPAC Name of 3,5-Dimethoxystilbene is 1,3-dimethoxy-5-[(E)-2-phenylethenyl]benzene.
What is the InChI of 3,5-Dimethoxystilbene?
The InChI of 3,5-Dimethoxystilbene is InChI=1S/C16H16O2/c1-17-15-10-14(11-16(12-15)18-2)9-8-13-6-4-3-5-7-13/h3-12H,1-2H3/b9-8+.
What is the Canonical SMILES of 3,5-Dimethoxystilbene?
The Canonical SMILES of 3,5-Dimethoxystilbene is COC1=CC(=CC(=C1)C=CC2=CC=CC=C2)OC.
How many hydrogen bond donor counts are there in 3,5-Dimethoxystilbene?
There are 0 hydrogen bond donor counts in 3,5-Dimethoxystilbene.
How many hydrogen bond acceptor counts are there in 3,5-Dimethoxystilbene?
There are 2 hydrogen bond acceptor counts in 3,5-Dimethoxystilbene.
How many rotatable bond counts are there in 3,5-Dimethoxystilbene?
There are 4 rotatable bond counts in 3,5-Dimethoxystilbene.
What is the exact mass of 3,5-Dimethoxystilbene?
The exact mass of 3,5-Dimethoxystilbene is 240.115029749 g/mol.
How many heavy atom counts are there in 3,5-Dimethoxystilbene?
There are 18 heavy atom counts in 3,5-Dimethoxystilbene.