What is the molecular formula of 3,5-Diiodosalicylic acid?
The molecular formula of 3,5-Diiodosalicylic acid is C7H4I2O3.
What is the molecular weight of 3,5-Diiodosalicylic acid?
The molecular weight of 3,5-Diiodosalicylic acid is 389.91 g/mol.
What is the IUPAC name of 3,5-Diiodosalicylic acid?
The IUPAC name of 3,5-Diiodosalicylic acid is 2-hydroxy-3,5-diiodobenzoic acid.
What is the InChI of 3,5-Diiodosalicylic acid?
The InChI of 3,5-Diiodosalicylic acid is InChI=1S/C7H4I2O3/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2,10H,(H,11,12).
What is the InChIKey of 3,5-Diiodosalicylic acid?
The InChIKey of 3,5-Diiodosalicylic acid is DHZVWQPHNWDCFS-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Diiodosalicylic acid?
The canonical SMILES of 3,5-Diiodosalicylic acid is C1=C(C=C(C(=C1C(=O)O)O)I)I.
What is the CAS number of 3,5-Diiodosalicylic acid?
The CAS number of 3,5-Diiodosalicylic acid is 133-91-5.
What is the XLogP3 value of 3,5-Diiodosalicylic acid?
The XLogP3 value of 3,5-Diiodosalicylic acid is 4.6.
How many hydrogen bond donor atoms are there in 3,5-Diiodosalicylic acid?
There are 2 hydrogen bond donor atoms in 3,5-Diiodosalicylic acid.
How many hydrogen bond acceptor atoms are there in 3,5-Diiodosalicylic acid?
There are 3 hydrogen bond acceptor atoms in 3,5-Diiodosalicylic acid.