What is the molecular formula of 3,5-Difluoro-2-methoxyphenylboronic acid?
The molecular formula is C7H7BF2O3.
What are the synonyms of 3,5-Difluoro-2-methoxyphenylboronic acid?
The synonyms are 737000-76-9, 3,5-Difluoro-2-methoxyphenylboronic acid, (3,5-difluoro-2-methoxyphenyl)boronic acid, 3,5-Difluoro-2-methoxybenzeneboronic acid, and MFCD03095353.
What is the molecular weight of 3,5-Difluoro-2-methoxyphenylboronic acid?
The molecular weight is 187.94 g/mol.
When was it created and modified?
It was created on 2005-07-19 and modified on 2023-12-02.
What is the IUPAC name of 3,5-Difluoro-2-methoxyphenylboronic acid?
The IUPAC name is (3,5-difluoro-2-methoxyphenyl)boronic acid.
What is the InChI of 3,5-Difluoro-2-methoxyphenylboronic acid?
The InChI is InChI=1S/C7H7BF2O3/c1-13-7-5(8(11)12)2-4(9)3-6(7)10/h2-3,11-12H,1H3.
What is the InChIKey of 3,5-Difluoro-2-methoxyphenylboronic acid?
The InChIKey is JXQHRWOUVJRCSR-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Difluoro-2-methoxyphenylboronic acid?
The canonical SMILES is B(C1=CC(=CC(=C1OC)F)F)(O)O.
What is the CAS number of 3,5-Difluoro-2-methoxyphenylboronic acid?
The CAS number is 737000-76-9.
What is the molecular weight, hydrogen bond donor count, hydrogen bond acceptor count, and rotatable bond count of 3,5-Difluoro-2-methoxyphenylboronic acid?
The molecular weight is 187.94 g/mol, the hydrogen bond donor count is 2, the hydrogen bond acceptor count is 5, and the rotatable bond count is 2.
※ Please kindly note that our products are for research use only.