What is the molecular formula of 3,5-Dibromoaniline?
The molecular formula is C6H5Br2N.
What is the molecular weight of 3,5-Dibromoaniline?
The molecular weight is 250.92 g/mol.
What is the IUPAC name of 3,5-Dibromoaniline?
The IUPAC name is 3,5-dibromoaniline.
What is the InChI of 3,5-Dibromoaniline?
The InChI is InChI=1S/C6H5Br2N/c7-4-1-5(8)3-6(9)2-4/h1-3H,9H2.
What is the InChIKey of 3,5-Dibromoaniline?
The InChIKey is RVNUUWJGSOHMRR-UHFFFAOYSA-N.
What is the canonical SMILES of 3,5-Dibromoaniline?
The canonical SMILES is C1=C(C=C(C=C1Br)Br)N.
What is the CAS number of 3,5-Dibromoaniline?
The CAS number is 626-40-4.
What is the EC number of 3,5-Dibromoaniline?
The EC number is 640-157-8.
What is the DSSTox Substance ID of 3,5-Dibromoaniline?
The DSSTox Substance ID is DTXSID40278120.
Is 3,5-Dibromoaniline a canonicalized compound?
Yes, 3,5-Dibromoaniline is a canonicalized compound.